C18H34O — CID 89451397
(2E,4E)-6-tert-butyl-5-ethyl-2-methoxy-8,8-dimethylnona-2,4-diene (PubChem CID 89451397) has the molecular formula C18H34O and a molecular weight of 266.47 g/mol. Its IUPAC name is (2E,4E)-6-tert-butyl-5-ethyl-2-methoxy-8,8-dimethylnona-2,4-diene.
| Compound Name | (2E,4E)-6-tert-butyl-5-ethyl-2-methoxy-8,8-dimethylnona-2,4-diene |
|---|---|
| PubChem CID | 89451397 |
| Molecular Formula | C18H34O |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.26 |
| IUPAC Name | (2E,4E)-6-tert-butyl-5-ethyl-2-methoxy-8,8-dimethylnona-2,4-diene |
| SMILES | CC/C(=C\C=C(/C)OC)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H34O/c1-10-15(12-11-14(2)19-9)16(18(6,7)8)13-17(3,4)5/h11-12,16H,10,13H2,1-9H3/b14-11+,15-12+ |
| InChIKey | AHLXQIZOCMVWLZ-LCPPQYOVSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|