C21H30O4 — CID 89451408
3-[2-hydroxy-3-[(1S,2R,3R)-3-hydroxy-2-[(E,4S)-4-methylhex-1-enyl]cyclopentyl]phenyl]propanoic acid (PubChem CID 89451408) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is 3-[2-hydroxy-3-[(1S,2R,3R)-3-hydroxy-2-[(E,4S)-4-methylhex-1-enyl]cyclopentyl]phenyl]propanoic acid.
| Compound Name | 3-[2-hydroxy-3-[(1S,2R,3R)-3-hydroxy-2-[(E,4S)-4-methylhex-1-enyl]cyclopentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 89451408 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 3-[2-hydroxy-3-[(1S,2R,3R)-3-hydroxy-2-[(E,4S)-4-methylhex-1-enyl]cyclopentyl]phenyl]propanoic acid |
| SMILES | CC[C@H](C)C/C=C/[C@H]1[C@H](O)CC[C@@H]1c1cccc(CCC(=O)O)c1O |
| InChI | InChI=1S/C21H30O4/c1-3-14(2)6-4-8-17-16(11-12-19(17)22)18-9-5-7-15(21(18)25)10-13-20(23)24/h4-5,7-9,14,16-17,19,22,25H,3,6,10-13H2,1-2H3,(H,23,24)/b8-4+/t14-,16-,17+,19+/m0/s1 |
| InChIKey | VXWWCHWGBPHQRN-HYVXYOBMSA-N |
| XLogP | 4.26 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|