C14H12N4OS — CID 89452202
N-(furan-2-ylmethyl)-10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452202) has the molecular formula C14H12N4OS and a molecular weight of 284.34 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-(furan-2-ylmethyl)-10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452202 |
| Molecular Formula | C14H12N4OS |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-10-methyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1ccc2c(n1)sc1c(NCc3ccco3)n[nH]c12 |
| InChI | InChI=1S/C14H12N4OS/c1-8-4-5-10-11-12(20-14(10)16-8)13(18-17-11)15-7-9-3-2-6-19-9/h2-6H,7H2,1H3,(H2,15,17,18) |
| InChIKey | NOZVXNIVSOMFRB-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |