C18H18N4OS — CID 89452211
N-[(4-methoxyphenyl)methyl]-3,10-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452211) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-3,10-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-3,10-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452211 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-3,10-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | COc1ccc(CNc2nn(C)c3c2sc2nc(C)ccc23)cc1 |
| InChI | InChI=1S/C18H18N4OS/c1-11-4-9-14-15-16(24-18(14)20-11)17(21-22(15)2)19-10-12-5-7-13(23-3)8-6-12/h4-9H,10H2,1-3H3,(H,19,21) |
| InChIKey | CTQHOJILGXEHDG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |