C15H13ClN4OS — CID 89452249
11-chloro-N-(furan-2-ylmethyl)-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine (PubChem CID 89452249) has the molecular formula C15H13ClN4OS and a molecular weight of 332.82 g/mol. Its IUPAC name is 11-chloro-N-(furan-2-ylmethyl)-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine.
| Compound Name | 11-chloro-N-(furan-2-ylmethyl)-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
|---|---|
| PubChem CID | 89452249 |
| Molecular Formula | C15H13ClN4OS |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 11-chloro-N-(furan-2-ylmethyl)-10,12-dimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(12),2(6),4,8,10-pentaen-5-amine |
| SMILES | Cc1nc2sc3c(NCc4ccco4)n[nH]c3c2c(C)c1Cl |
| InChI | InChI=1S/C15H13ClN4OS/c1-7-10-12-13(22-15(10)18-8(2)11(7)16)14(20-19-12)17-6-9-4-3-5-21-9/h3-5H,6H2,1-2H3,(H2,17,19,20) |
| InChIKey | WABMFLFYJDPFRS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 66.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |