C18H18FN5S — CID 89452691
N-[(5-amino-2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452691) has the molecular formula C18H18FN5S and a molecular weight of 355.44 g/mol. Its IUPAC name is N-[(5-amino-2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-[(5-amino-2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452691 |
| Molecular Formula | C18H18FN5S |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N-[(5-amino-2-fluorophenyl)methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NCc3cc(N)ccc3F)nn(C)c12 |
| InChI | InChI=1S/C18H18FN5S/c1-9-6-10(2)22-18-14(9)15-16(25-18)17(23-24(15)3)21-8-11-7-12(20)4-5-13(11)19/h4-7H,8,20H2,1-3H3,(H,21,23) |
| InChIKey | LSKXXRINDYHTNW-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|