C16H21N5S — CID 89452703
3,10,12-trimethyl-N-(1-methylpyrrolidin-3-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452703) has the molecular formula C16H21N5S and a molecular weight of 315.45 g/mol. Its IUPAC name is 3,10,12-trimethyl-N-(1-methylpyrrolidin-3-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | 3,10,12-trimethyl-N-(1-methylpyrrolidin-3-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452703 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 3,10,12-trimethyl-N-(1-methylpyrrolidin-3-yl)-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NC3CCN(C)C3)nn(C)c12 |
| InChI | InChI=1S/C16H21N5S/c1-9-7-10(2)17-16-12(9)13-14(22-16)15(19-21(13)4)18-11-5-6-20(3)8-11/h7,11H,5-6,8H2,1-4H3,(H,18,19) |
| InChIKey | PJGUQYNSNQASTF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |