C17H17IN4OS — CID 89452785
N-[[5-(iodomethyl)furan-2-yl]methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine (PubChem CID 89452785) has the molecular formula C17H17IN4OS and a molecular weight of 452.32 g/mol. Its IUPAC name is N-[[5-(iodomethyl)furan-2-yl]methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine.
| Compound Name | N-[[5-(iodomethyl)furan-2-yl]methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
|---|---|
| PubChem CID | 89452785 |
| Molecular Formula | C17H17IN4OS |
| Molecular Weight | 452.32 g/mol |
| Exact Mass | 452.02 |
| IUPAC Name | N-[[5-(iodomethyl)furan-2-yl]methyl]-3,10,12-trimethyl-7-thia-3,4,9-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),4,9,11-pentaen-5-amine |
| SMILES | Cc1cc(C)c2c(n1)sc1c(NCc3ccc(CI)o3)nn(C)c12 |
| InChI | InChI=1S/C17H17IN4OS/c1-9-6-10(2)20-17-13(9)14-15(24-17)16(21-22(14)3)19-8-12-5-4-11(7-18)23-12/h4-6H,7-8H2,1-3H3,(H,19,21) |
| InChIKey | OBHJGOPSRQMCRH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 55.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.32 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|