About [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate
[butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 89452808) has the molecular formula C23H42N4O5S
and a molecular weight of 486.68 g/mol. Its IUPAC name is [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
Molecular Properties
| Compound Name | [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| PubChem CID | 89452808 |
| Molecular Formula | C23H42N4O5S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | CCCCN(OS(=O)(=O)ON1C(=O)N2CC1CC[C@H]2C#N)C(CCC)(CCCC)CCCC |
| InChI | InChI=1S/C23H42N4O5S/c1-5-9-15-23(14-8-4,16-10-6-2)26(17-11-7-3)31-33(29,30)32-27-21-13-12-20(18-24)25(19-21)22(27)28/h20-21H,5-17,19H2,1-4H3/t20-,21?/m0/s1 |
| InChIKey | CSVDYTAPLJUHKJ-BGERDNNASA-N |
| XLogP | 4.91 |
| TPSA | 103.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The IUPAC name of [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (CID 89452808) is [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
What is the SMILES notation for [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The canonical SMILES for [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate is CCCCN(OS(=O)(=O)ON1C(=O)N2CC1CC[C@H]2C#N)C(CCC)(CCCC)CCCC.
What is the InChIKey of [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
The InChIKey is CSVDYTAPLJUHKJ-BGERDNNASA-N. The full InChI is InChI=1S/C23H42N4O5S/c1-5-9-15-23(14-8-4,16-10-6-2)26(17-11-7-3)31-33(29,30)32-27-21-13-12-20(18-24)25(19-21)22(27)28/h20-21H,5-17,19H2,1-4H3/t20-,21?/m0/s1.
What are the key properties of [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate?
[butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate has a molecular weight of 486.68 g/mol, XLogP of 4.91, 16 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [butyl(5-propylnonan-5-yl)amino] [(2S)-2-cyano-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate is sourced from PubChem (CID 89452808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).