C23H21F3IN5O3S — CID 89452997
4,4,4-trifluoro-1-[(3S,4R)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 89452997) has the molecular formula C23H21F3IN5O3S and a molecular weight of 631.42 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-[(3S,4R)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | 4,4,4-trifluoro-1-[(3S,4R)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 89452997 |
| Molecular Formula | C23H21F3IN5O3S |
| Molecular Weight | 631.42 g/mol |
| Exact Mass | 631.04 |
| IUPAC Name | 4,4,4-trifluoro-1-[(3S,4R)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2ncc([C@H]4CN(C(=O)CCC(F)(F)F)C[C@H]4I)n23)cc1 |
| InChI | InChI=1S/C23H21F3IN5O3S/c1-14-2-4-15(5-3-14)36(34,35)31-9-7-18-22(31)29-11-20-28-10-19(32(18)20)16-12-30(13-17(16)27)21(33)6-8-23(24,25)26/h2-5,7,9-11,16-17H,6,8,12-13H2,1H3/t16-,17+/m0/s1 |
| InChIKey | XLKUQGDUGQTDCM-DLBZAZTESA-N |
| XLogP | 4.30 |
| TPSA | 89.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.42 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|