C22H22FIN6O3S — CID 89453012
(3S,4R)-N-(2-fluoroethyl)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidine-1-carboxamide (PubChem CID 89453012) has the molecular formula C22H22FIN6O3S and a molecular weight of 596.43 g/mol. Its IUPAC name is (3S,4R)-N-(2-fluoroethyl)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidine-1-carboxamide.
| Compound Name | (3S,4R)-N-(2-fluoroethyl)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 89453012 |
| Molecular Formula | C22H22FIN6O3S |
| Molecular Weight | 596.43 g/mol |
| Exact Mass | 596.05 |
| IUPAC Name | (3S,4R)-N-(2-fluoroethyl)-3-iodo-4-[5-(4-methylphenyl)sulfonyl-1,5,7,10-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),3,7,9,11-pentaen-12-yl]pyrrolidine-1-carboxamide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2ncc2ncc([C@H]4CN(C(=O)NCCF)C[C@H]4I)n23)cc1 |
| InChI | InChI=1S/C22H22FIN6O3S/c1-14-2-4-15(5-3-14)34(32,33)29-9-6-18-21(29)27-11-20-26-10-19(30(18)20)16-12-28(13-17(16)24)22(31)25-8-7-23/h2-6,9-11,16-17H,7-8,12-13H2,1H3,(H,25,31)/t16-,17+/m0/s1 |
| InChIKey | XAZAFKUQNGYLND-DLBZAZTESA-N |
| XLogP | 3.11 |
| TPSA | 101.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|