C20H31NO — CID 89453028
(4Z)-N-[(3Z,5Z)-8-methyl-3-propan-2-ylnona-1,3,5-trien-2-yl]hepta-4,6-dienamide (PubChem CID 89453028) has the molecular formula C20H31NO and a molecular weight of 301.47 g/mol. Its IUPAC name is (4Z)-N-[(3Z,5Z)-8-methyl-3-propan-2-ylnona-1,3,5-trien-2-yl]hepta-4,6-dienamide.
| Compound Name | (4Z)-N-[(3Z,5Z)-8-methyl-3-propan-2-ylnona-1,3,5-trien-2-yl]hepta-4,6-dienamide |
|---|---|
| PubChem CID | 89453028 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | (4Z)-N-[(3Z,5Z)-8-methyl-3-propan-2-ylnona-1,3,5-trien-2-yl]hepta-4,6-dienamide |
| SMILES | C=C/C=C\CCC(=O)NC(=C)/C(=C\C=C/CC(C)C)C(C)C |
| InChI | InChI=1S/C20H31NO/c1-7-8-9-10-15-20(22)21-18(6)19(17(4)5)14-12-11-13-16(2)3/h7-9,11-12,14,16-17H,1,6,10,13,15H2,2-5H3,(H,21,22)/b9-8-,12-11-,19-14- |
| InChIKey | RBFSSZFIVXSHDT-CLJNWMMFSA-N |
| XLogP | 5.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|