About cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine
cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine (PubChem CID 89453072) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine.
Molecular Properties
| Compound Name | cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine |
| PubChem CID | 89453072 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine |
| SMILES | C[C@H]1CC[C@@H](N(Cc2ccccc2)Cc2ccccc2)C1 |
| InChI | InChI=1S/C20H25N/c1-17-12-13-20(14-17)21(15-18-8-4-2-5-9-18)16-19-10-6-3-7-11-19/h2-11,17,20H,12-16H2,1H3/t17-,20+/m0/s1 |
| InChIKey | YGFHLFAAACGWPV-FXAWDEMLSA-N |
| XLogP | 4.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine?
The IUPAC name of cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine (CID 89453072) is cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine.
What is the SMILES notation for cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine?
The canonical SMILES for cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine is C[C@H]1CC[C@@H](N(Cc2ccccc2)Cc2ccccc2)C1.
What is the InChIKey of cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine?
The InChIKey is YGFHLFAAACGWPV-FXAWDEMLSA-N. The full InChI is InChI=1S/C20H25N/c1-17-12-13-20(14-17)21(15-18-8-4-2-5-9-18)16-19-10-6-3-7-11-19/h2-11,17,20H,12-16H2,1H3/t17-,20+/m0/s1.
What are the key properties of cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine?
cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine has a molecular weight of 279.43 g/mol, XLogP of 4.88, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,3S)-N,N-dibenzyl-3-methylcyclopentan-1-amine is sourced from PubChem (CID 89453072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).