C19H30N4O3Si — CID 89453137
2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 89453137) has the molecular formula C19H30N4O3Si and a molecular weight of 390.56 g/mol. Its IUPAC name is 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 89453137 |
| Molecular Formula | C19H30N4O3Si |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(3,3-dimethylpyrrolidin-1-yl)-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | CC1(C)CCN(c2cnc3c(n2)c(C(=O)O)cn3COCC[Si](C)(C)C)C1 |
| InChI | InChI=1S/C19H30N4O3Si/c1-19(2)6-7-22(12-19)15-10-20-17-16(21-15)14(18(24)25)11-23(17)13-26-8-9-27(3,4)5/h10-11H,6-9,12-13H2,1-5H3,(H,24,25) |
| InChIKey | UFSIDDGWHQMFDG-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|