C16H25N5O4Si — CID 89453157
2-[[2-(methylamino)-2-oxoethyl]amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid (PubChem CID 89453157) has the molecular formula C16H25N5O4Si and a molecular weight of 379.49 g/mol. Its IUPAC name is 2-[[2-(methylamino)-2-oxoethyl]amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid.
| Compound Name | 2-[[2-(methylamino)-2-oxoethyl]amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 89453157 |
| Molecular Formula | C16H25N5O4Si |
| Molecular Weight | 379.49 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[[2-(methylamino)-2-oxoethyl]amino]-5-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-b]pyrazine-7-carboxylic acid |
| SMILES | CNC(=O)CNc1cnc2c(n1)c(C(=O)O)cn2COCC[Si](C)(C)C |
| InChI | InChI=1S/C16H25N5O4Si/c1-17-13(22)8-18-12-7-19-15-14(20-12)11(16(23)24)9-21(15)10-25-5-6-26(2,3)4/h7,9H,5-6,8,10H2,1-4H3,(H,17,22)(H,18,20)(H,23,24) |
| InChIKey | DIWVCULBOPMEMI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 118.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|