About 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride
1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride (PubChem CID 89454227) has the molecular formula C9H13FN2O3
and a molecular weight of 216.21 g/mol. Its IUPAC name is 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride.
Molecular Properties
| Compound Name | 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride |
| PubChem CID | 89454227 |
| Molecular Formula | C9H13FN2O3 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride |
| SMILES | F.O=C(O)c1cnn(C2CCCCO2)c1 |
| InChI | InChI=1S/C9H12N2O3.FH/c12-9(13)7-5-10-11(6-7)8-3-1-2-4-14-8;/h5-6,8H,1-4H2,(H,12,13);1H |
| InChIKey | SLHLJVUSVIIGST-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride?
The IUPAC name of 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride (CID 89454227) is 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride.
What is the SMILES notation for 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride?
The canonical SMILES for 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride is F.O=C(O)c1cnn(C2CCCCO2)c1.
What is the InChIKey of 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride?
The InChIKey is SLHLJVUSVIIGST-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O3.FH/c12-9(13)7-5-10-11(6-7)8-3-1-2-4-14-8;/h5-6,8H,1-4H2,(H,12,13);1H.
What are the key properties of 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride?
1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride has a molecular weight of 216.21 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxan-2-yl)pyrazole-4-carboxylic acid;hydrofluoride is sourced from PubChem (CID 89454227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).