C21H26N4O2Si — CID 89454235
7-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-5,9b-dihydro-1H-pyrazolo[4,3-c]quinolin-4-one (PubChem CID 89454235) has the molecular formula C21H26N4O2Si and a molecular weight of 394.55 g/mol. Its IUPAC name is 7-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-5,9b-dihydro-1H-pyrazolo[4,3-c]quinolin-4-one.
| Compound Name | 7-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-5,9b-dihydro-1H-pyrazolo[4,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 89454235 |
| Molecular Formula | C21H26N4O2Si |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.18 |
| IUPAC Name | 7-pyridin-4-yl-2-(2-trimethylsilylethoxymethyl)-5,9b-dihydro-1H-pyrazolo[4,3-c]quinolin-4-one |
| SMILES | C[Si](C)(C)CCOCN1C=C2C(=O)Nc3cc(-c4ccncc4)ccc3C2N1 |
| InChI | InChI=1S/C21H26N4O2Si/c1-28(2,3)11-10-27-14-25-13-18-20(24-25)17-5-4-16(12-19(17)23-21(18)26)15-6-8-22-9-7-15/h4-9,12-13,20,24H,10-11,14H2,1-3H3,(H,23,26) |
| InChIKey | OUOWRIBYQNXQHA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|