C22H20F4N4O2 — CID 89454302
7-(2-fluoro-3-pyridinyl)-2-(oxan-2-yl)-5-(2,2,2-trifluoroethyl)-1,3-dihydropyrazolo[4,3-c]quinolin-4-one (PubChem CID 89454302) has the molecular formula C22H20F4N4O2 and a molecular weight of 448.42 g/mol. Its IUPAC name is 7-(2-fluoro-3-pyridinyl)-2-(oxan-2-yl)-5-(2,2,2-trifluoroethyl)-1,3-dihydropyrazolo[4,3-c]quinolin-4-one.
| Compound Name | 7-(2-fluoro-3-pyridinyl)-2-(oxan-2-yl)-5-(2,2,2-trifluoroethyl)-1,3-dihydropyrazolo[4,3-c]quinolin-4-one |
|---|---|
| PubChem CID | 89454302 |
| Molecular Formula | C22H20F4N4O2 |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 7-(2-fluoro-3-pyridinyl)-2-(oxan-2-yl)-5-(2,2,2-trifluoroethyl)-1,3-dihydropyrazolo[4,3-c]quinolin-4-one |
| SMILES | O=c1c2c(c3ccc(-c4cccnc4F)cc3n1CC(F)(F)F)NN(C1CCCCO1)C2 |
| InChI | InChI=1S/C22H20F4N4O2/c23-20-14(4-3-8-27-20)13-6-7-15-17(10-13)29(12-22(24,25)26)21(31)16-11-30(28-19(15)16)18-5-1-2-9-32-18/h3-4,6-8,10,18,28H,1-2,5,9,11-12H2 |
| InChIKey | ICYNOQXHGKDTDW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|