C36H54N6Si3 — CID 89455826
N-[[3,4-bis[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine (PubChem CID 89455826) has the molecular formula C36H54N6Si3 and a molecular weight of 655.13 g/mol. Its IUPAC name is N-[[3,4-bis[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine.
| Compound Name | N-[[3,4-bis[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
|---|---|
| PubChem CID | 89455826 |
| Molecular Formula | C36H54N6Si3 |
| Molecular Weight | 655.13 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | N-[[3,4-bis[benzyl(trimethylsilyl)hydrazinylidene]cyclohexylidene]amino]-1-phenyl-N-trimethylsilylmethanamine |
| SMILES | C[Si](C)(C)N(Cc1ccccc1)N=C1CCC(=NN(Cc2ccccc2)[Si](C)(C)C)C(=NN(Cc2ccccc2)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C36H54N6Si3/c1-43(2,3)40(28-31-19-13-10-14-20-31)37-34-25-26-35(38-41(44(4,5)6)29-32-21-15-11-16-22-32)36(27-34)39-42(45(7,8)9)30-33-23-17-12-18-24-33/h10-24H,25-30H2,1-9H3 |
| InChIKey | OBMUXNQKWPUITD-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 46.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.13 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|