About N,N'-di(piperidin-1-yl)propane-1,3-diimine
N,N'-di(piperidin-1-yl)propane-1,3-diimine (PubChem CID 89456098) has the molecular formula C13H24N4
and a molecular weight of 236.36 g/mol. Its IUPAC name is N,N'-di(piperidin-1-yl)propane-1,3-diimine.
Molecular Properties
| Compound Name | N,N'-di(piperidin-1-yl)propane-1,3-diimine |
| PubChem CID | 89456098 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | N,N'-di(piperidin-1-yl)propane-1,3-diimine |
| SMILES | C(CC=NN1CCCCC1)=NN1CCCCC1 |
| InChI | InChI=1S/C13H24N4/c1-3-10-16(11-4-1)14-8-7-9-15-17-12-5-2-6-13-17/h8-9H,1-7,10-13H2 |
| InChIKey | PINRSEHBMPMXML-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,N'-di(piperidin-1-yl)propane-1,3-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-di(piperidin-1-yl)propane-1,3-diimine?
The IUPAC name of N,N'-di(piperidin-1-yl)propane-1,3-diimine (CID 89456098) is N,N'-di(piperidin-1-yl)propane-1,3-diimine.
What is the SMILES notation for N,N'-di(piperidin-1-yl)propane-1,3-diimine?
The canonical SMILES for N,N'-di(piperidin-1-yl)propane-1,3-diimine is C(CC=NN1CCCCC1)=NN1CCCCC1.
What is the InChIKey of N,N'-di(piperidin-1-yl)propane-1,3-diimine?
The InChIKey is PINRSEHBMPMXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N4/c1-3-10-16(11-4-1)14-8-7-9-15-17-12-5-2-6-13-17/h8-9H,1-7,10-13H2.
What are the key properties of N,N'-di(piperidin-1-yl)propane-1,3-diimine?
N,N'-di(piperidin-1-yl)propane-1,3-diimine has a molecular weight of 236.36 g/mol, XLogP of 2.32, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-di(piperidin-1-yl)propane-1,3-diimine is sourced from PubChem (CID 89456098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).