C34H47FN6O4Si — CID 89456333
tert-butyl 6-[2-fluoro-6-[[4-(2-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate (PubChem CID 89456333) has the molecular formula C34H47FN6O4Si and a molecular weight of 650.87 g/mol. Its IUPAC name is tert-butyl 6-[2-fluoro-6-[[4-(2-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate.
| Compound Name | tert-butyl 6-[2-fluoro-6-[[4-(2-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
|---|---|
| PubChem CID | 89456333 |
| Molecular Formula | C34H47FN6O4Si |
| Molecular Weight | 650.87 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | tert-butyl 6-[2-fluoro-6-[[4-(2-methyl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)imidazole-2-carbonyl]amino]phenyl]-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine-1-carboxylate |
| SMILES | Cc1cc(-c2cn(COCC[Si](C)(C)C)c(C(=O)Nc3cccc(F)c3N3CCC4CCN(C(=O)OC(C)(C)C)C4C3)n2)ccn1 |
| InChI | InChI=1S/C34H47FN6O4Si/c1-23-19-25(11-14-36-23)28-20-40(22-44-17-18-46(5,6)7)31(37-28)32(42)38-27-10-8-9-26(35)30(27)39-15-12-24-13-16-41(29(24)21-39)33(43)45-34(2,3)4/h8-11,14,19-20,24,29H,12-13,15-18,21-22H2,1-7H3,(H,38,42) |
| InChIKey | FUAISQYDDTWTLT-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.87 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|