About [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid
[1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid (PubChem CID 89456662) has the molecular formula C12H17F2N5O5
and a molecular weight of 349.29 g/mol. Its IUPAC name is [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid.
Molecular Properties
| Compound Name | [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid |
| PubChem CID | 89456662 |
| Molecular Formula | C12H17F2N5O5 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CCC1O |
| InChI | InChI=1S/C12H17F2N5O5/c13-10(14)6-18-11(8(5-15-18)19(23)24)17-3-1-7(16-12(21)22)9(20)2-4-17/h5,7,9-10,16,20H,1-4,6H2,(H,21,22) |
| InChIKey | WSPXSGMZSRZLCZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid?
The IUPAC name of [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid (CID 89456662) is [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid.
What is the SMILES notation for [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid?
The canonical SMILES for [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid is O=C(O)NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CCC1O.
What is the InChIKey of [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid?
The InChIKey is WSPXSGMZSRZLCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F2N5O5/c13-10(14)6-18-11(8(5-15-18)19(23)24)17-3-1-7(16-12(21)22)9(20)2-4-17/h5,7,9-10,16,20H,1-4,6H2,(H,21,22).
What are the key properties of [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid?
[1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid has a molecular weight of 349.29 g/mol, XLogP of 0.65, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid is sourced from PubChem (CID 89456662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).