C12H17F2N5O5 — CID 89456662
[1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid (PubChem CID 89456662) has the molecular formula C12H17F2N5O5 and a molecular weight of 349.29 g/mol. Its IUPAC name is [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid.
| Compound Name | [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid |
|---|---|
| PubChem CID | 89456662 |
| Molecular Formula | C12H17F2N5O5 |
| Molecular Weight | 349.29 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [1-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-5-hydroxyazepan-4-yl]carbamic acid |
| SMILES | O=C(O)NC1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CCC1O |
| InChI | InChI=1S/C12H17F2N5O5/c13-10(14)6-18-11(8(5-15-18)19(23)24)17-3-1-7(16-12(21)22)9(20)2-4-17/h5,7,9-10,16,20H,1-4,6H2,(H,21,22) |
| InChIKey | WSPXSGMZSRZLCZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 133.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|