About 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine
1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine (PubChem CID 89456783) has the molecular formula C10H17F2N5
and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine.
Molecular Properties
| Compound Name | 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine |
| PubChem CID | 89456783 |
| Molecular Formula | C10H17F2N5 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine |
| SMILES | Cn1ncc(N)c1N1CCC(N)CC(F)(F)C1 |
| InChI | InChI=1S/C10H17F2N5/c1-16-9(8(14)5-15-16)17-3-2-7(13)4-10(11,12)6-17/h5,7H,2-4,6,13-14H2,1H3 |
| InChIKey | YQBZZJOMEYGOPL-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine?
The IUPAC name of 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine (CID 89456783) is 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine.
What is the SMILES notation for 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine?
The canonical SMILES for 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine is Cn1ncc(N)c1N1CCC(N)CC(F)(F)C1.
What is the InChIKey of 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine?
The InChIKey is YQBZZJOMEYGOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2N5/c1-16-9(8(14)5-15-16)17-3-2-7(13)4-10(11,12)6-17/h5,7H,2-4,6,13-14H2,1H3.
What are the key properties of 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine?
1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine has a molecular weight of 245.28 g/mol, XLogP of 0.57, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-amino-1-methylpyrazol-5-yl)-6,6-difluoroazepan-4-amine is sourced from PubChem (CID 89456783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).