C11H15F2N5O5 — CID 89456881
4-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-6-hydroxy-1,4-diazepane-1-carboxylic acid (PubChem CID 89456881) has the molecular formula C11H15F2N5O5 and a molecular weight of 335.27 g/mol. Its IUPAC name is 4-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-6-hydroxy-1,4-diazepane-1-carboxylic acid.
| Compound Name | 4-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-6-hydroxy-1,4-diazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 89456881 |
| Molecular Formula | C11H15F2N5O5 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 4-[1-(2,2-difluoroethyl)-4-nitropyrazol-5-yl]-6-hydroxy-1,4-diazepane-1-carboxylic acid |
| SMILES | O=C(O)N1CCN(c2c([N+](=O)[O-])cnn2CC(F)F)CC(O)C1 |
| InChI | InChI=1S/C11H15F2N5O5/c12-9(13)6-17-10(8(3-14-17)18(22)23)15-1-2-16(11(20)21)5-7(19)4-15/h3,7,9,19H,1-2,4-6H2,(H,20,21) |
| InChIKey | SNBLVGKXEKDZSA-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|