C21H32N8O3Si — CID 89457138
[3-[[2-[(1-methylpyrazol-4-yl)amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclobutyl]carbamic acid (PubChem CID 89457138) has the molecular formula C21H32N8O3Si and a molecular weight of 472.63 g/mol. Its IUPAC name is [3-[[2-[(1-methylpyrazol-4-yl)amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclobutyl]carbamic acid.
| Compound Name | [3-[[2-[(1-methylpyrazol-4-yl)amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclobutyl]carbamic acid |
|---|---|
| PubChem CID | 89457138 |
| Molecular Formula | C21H32N8O3Si |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.24 |
| IUPAC Name | [3-[[2-[(1-methylpyrazol-4-yl)amino]-7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]amino]cyclobutyl]carbamic acid |
| SMILES | Cn1cc(Nc2nc(NC3CC(NC(=O)O)C3)c3ccn(COCC[Si](C)(C)C)c3n2)cn1 |
| InChI | InChI=1S/C21H32N8O3Si/c1-28-12-16(11-22-28)24-20-26-18(23-14-9-15(10-14)25-21(30)31)17-5-6-29(19(17)27-20)13-32-7-8-33(2,3)4/h5-6,11-12,14-15,25H,7-10,13H2,1-4H3,(H,30,31)(H2,23,24,26,27) |
| InChIKey | QLMOGFFKJFIKRE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 131.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|