About chloro-diisopropylamino silane
chloro-diisopropylamino silane (PubChem CID 89457788) has the molecular formula C6H14ClNSi
and a molecular weight of 163.72 g/mol.
Molecular Properties
| Compound Name | chloro-diisopropylamino silane |
| PubChem CID | 89457788 |
| Molecular Formula | C6H14ClNSi |
| Molecular Weight | 163.72 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | — |
| SMILES | CC(C)N([Si]Cl)C(C)C |
| InChI | InChI=1S/C6H14ClNSi/c1-5(2)8(9-7)6(3)4/h5-6H,1-4H3 |
| InChIKey | DELTZTQKYSKFRX-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.72 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-diisopropylamino silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-diisopropylamino silane?
The IUPAC name of chloro-diisopropylamino silane (CID 89457788) is not available.
What is the SMILES notation for chloro-diisopropylamino silane?
The canonical SMILES for chloro-diisopropylamino silane is CC(C)N([Si]Cl)C(C)C.
What is the InChIKey of chloro-diisopropylamino silane?
The InChIKey is DELTZTQKYSKFRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClNSi/c1-5(2)8(9-7)6(3)4/h5-6H,1-4H3.
What are the key properties of chloro-diisopropylamino silane?
chloro-diisopropylamino silane has a molecular weight of 163.72 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-diisopropylamino silane is sourced from PubChem (CID 89457788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).