C19H10ClF2N3O3S — CID 89458087
4-(4-chlorophenyl)-2-[(4,6-difluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 89458087) has the molecular formula C19H10ClF2N3O3S and a molecular weight of 433.82 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(4,6-difluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[(4,6-difluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458087 |
| Molecular Formula | C19H10ClF2N3O3S |
| Molecular Weight | 433.82 g/mol |
| Exact Mass | 433.01 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(4,6-difluoropyrazolo[1,5-a]pyridine-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Cl)cc2)c1C(=O)O)c1cc2c(F)cc(F)cn2n1 |
| InChI | InChI=1S/C19H10ClF2N3O3S/c20-10-3-1-9(2-4-10)12-8-29-18(16(12)19(27)28)23-17(26)14-6-15-13(22)5-11(21)7-25(15)24-14/h1-8H,(H,23,26)(H,27,28) |
| InChIKey | VRFVYAKCFPLCLJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|