C14H23N2+ — CID 89458228
1,7-di(propan-2-yl)-6,8-dihydro-5H-1,7-naphthyridin-1-ium (PubChem CID 89458228) has the molecular formula C14H23N2+ and a molecular weight of 219.35 g/mol. Its IUPAC name is 1,7-di(propan-2-yl)-6,8-dihydro-5H-1,7-naphthyridin-1-ium.
| Compound Name | 1,7-di(propan-2-yl)-6,8-dihydro-5H-1,7-naphthyridin-1-ium |
|---|---|
| PubChem CID | 89458228 |
| Molecular Formula | C14H23N2+ |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.19 |
| IUPAC Name | 1,7-di(propan-2-yl)-6,8-dihydro-5H-1,7-naphthyridin-1-ium |
| SMILES | CC(C)N1CCc2ccc[n+](C(C)C)c2C1 |
| InChI | InChI=1S/C14H23N2/c1-11(2)15-9-7-13-6-5-8-16(12(3)4)14(13)10-15/h5-6,8,11-12H,7,9-10H2,1-4H3/q+1 |
| InChIKey | JOBUFSPWOHVWQT-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|