1-methylpyrazole-4-carbonyl fluoride

C5H5FN2O — CID 89458229

IUPAC1-methylpyrazole-4-carbonyl fluoride
SMILESCn1cc(C(=O)F)cn1
InChIInChI=1S/C5H5FN2O/c1-8-3-4(2-7-8)5(6)9/h2-3H,1H3
InChIKeyWLTNHRGXVIPOKJ-UHFFFAOYSA-N
MW128.11 g/mol
LogP0.53
Rot. Bonds1

About 1-methylpyrazole-4-carbonyl fluoride

1-methylpyrazole-4-carbonyl fluoride (PubChem CID 89458229) has the molecular formula C5H5FN2O and a molecular weight of 128.11 g/mol. Its IUPAC name is 1-methylpyrazole-4-carbonyl fluoride.

Molecular Properties

Compound Name1-methylpyrazole-4-carbonyl fluoride
PubChem CID89458229
Molecular FormulaC5H5FN2O
Molecular Weight128.11 g/mol
Exact Mass128.04
IUPAC Name1-methylpyrazole-4-carbonyl fluoride
SMILESCn1cc(C(=O)F)cn1
InChIInChI=1S/C5H5FN2O/c1-8-3-4(2-7-8)5(6)9/h2-3H,1H3
InChIKeyWLTNHRGXVIPOKJ-UHFFFAOYSA-N
XLogP0.53
TPSA34.89 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500128.11
LogP ≤ 50.53
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 1-methylpyrazole-4-carbonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylpyrazole-4-carbonyl fluoride?
The IUPAC name of 1-methylpyrazole-4-carbonyl fluoride (CID 89458229) is 1-methylpyrazole-4-carbonyl fluoride.
What is the SMILES notation for 1-methylpyrazole-4-carbonyl fluoride?
The canonical SMILES for 1-methylpyrazole-4-carbonyl fluoride is Cn1cc(C(=O)F)cn1.
What is the InChIKey of 1-methylpyrazole-4-carbonyl fluoride?
The InChIKey is WLTNHRGXVIPOKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5FN2O/c1-8-3-4(2-7-8)5(6)9/h2-3H,1H3.
What are the key properties of 1-methylpyrazole-4-carbonyl fluoride?
1-methylpyrazole-4-carbonyl fluoride has a molecular weight of 128.11 g/mol, XLogP of 0.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazole-4-carbonyl fluoride is sourced from PubChem (CID 89458229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).