About (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane
(1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane (PubChem CID 89458348) has the molecular formula C12H25N2+
and a molecular weight of 197.35 g/mol. Its IUPAC name is (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane |
| PubChem CID | 89458348 |
| Molecular Formula | C12H25N2+ |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.20 |
| IUPAC Name | (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane |
| SMILES | CC(C)N1CC[N@@+]2(C(C)C)CC[C@@H]1C2 |
| InChI | InChI=1S/C12H25N2/c1-10(2)13-6-8-14(11(3)4)7-5-12(13)9-14/h10-12H,5-9H2,1-4H3/q+1/t12-,14+/m1/s1 |
| InChIKey | SIBPTIFDGNSTQX-OCCSQVGLSA-N |
| XLogP | 1.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane?
The IUPAC name of (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane (CID 89458348) is (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane.
What is the SMILES notation for (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane?
The canonical SMILES for (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane is CC(C)N1CC[N@@+]2(C(C)C)CC[C@@H]1C2.
What is the InChIKey of (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane?
The InChIKey is SIBPTIFDGNSTQX-OCCSQVGLSA-N. The full InChI is InChI=1S/C12H25N2/c1-10(2)13-6-8-14(11(3)4)7-5-12(13)9-14/h10-12H,5-9H2,1-4H3/q+1/t12-,14+/m1/s1.
What are the key properties of (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane?
(1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane has a molecular weight of 197.35 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,5R)-1,4-di(propan-2-yl)-4-aza-1-azoniabicyclo[3.2.1]octane is sourced from PubChem (CID 89458348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).