C13H21N2+ — CID 89458372
1,4-di(propan-2-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-4-ium (PubChem CID 89458372) has the molecular formula C13H21N2+ and a molecular weight of 205.32 g/mol. Its IUPAC name is 1,4-di(propan-2-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-4-ium.
| Compound Name | 1,4-di(propan-2-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-4-ium |
|---|---|
| PubChem CID | 89458372 |
| Molecular Formula | C13H21N2+ |
| Molecular Weight | 205.32 g/mol |
| Exact Mass | 205.17 |
| IUPAC Name | 1,4-di(propan-2-yl)-2,3-dihydropyrrolo[3,2-b]pyridin-4-ium |
| SMILES | CC(C)N1CCc2c1ccc[n+]2C(C)C |
| InChI | InChI=1S/C13H21N2/c1-10(2)14-8-5-6-12-13(14)7-9-15(12)11(3)4/h5-6,8,10-11H,7,9H2,1-4H3/q+1 |
| InChIKey | FSEMBXIUXPUPLC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.32 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|