C13H27N2+ — CID 89458388
N,4-di(propan-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-amine (PubChem CID 89458388) has the molecular formula C13H27N2+ and a molecular weight of 211.37 g/mol. Its IUPAC name is N,4-di(propan-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-amine.
| Compound Name | N,4-di(propan-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-amine |
|---|---|
| PubChem CID | 89458388 |
| Molecular Formula | C13H27N2+ |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.22 |
| IUPAC Name | N,4-di(propan-2-yl)-2,3,5,6,7,8-hexahydro-1H-pyrrolizin-4-ium-1-amine |
| SMILES | CC(C)NC1CC[N+]2(C(C)C)CCCC12 |
| InChI | InChI=1S/C13H27N2/c1-10(2)14-12-7-9-15(11(3)4)8-5-6-13(12)15/h10-14H,5-9H2,1-4H3/q+1 |
| InChIKey | ASBBJHBMXKZGHT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|