About 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione
5-propan-2-yl-1,4-dihydropyrazine-2,3-dione (PubChem CID 89458462) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione.
Molecular Properties
| Compound Name | 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione |
| PubChem CID | 89458462 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione |
| SMILES | CC(C)c1c[nH]c(=O)c(=O)[nH]1 |
| InChI | InChI=1S/C7H10N2O2/c1-4(2)5-3-8-6(10)7(11)9-5/h3-4H,1-2H3,(H,8,10)(H,9,11) |
| InChIKey | USBBXHRTMPSAJM-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione?
The IUPAC name of 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione (CID 89458462) is 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione.
What is the SMILES notation for 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione?
The canonical SMILES for 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione is CC(C)c1c[nH]c(=O)c(=O)[nH]1.
What is the InChIKey of 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione?
The InChIKey is USBBXHRTMPSAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4(2)5-3-8-6(10)7(11)9-5/h3-4H,1-2H3,(H,8,10)(H,9,11).
What are the key properties of 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione?
5-propan-2-yl-1,4-dihydropyrazine-2,3-dione has a molecular weight of 154.17 g/mol, XLogP of 0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-propan-2-yl-1,4-dihydropyrazine-2,3-dione is sourced from PubChem (CID 89458462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).