C22H31N5O3S — CID 89458634
5-methylsulfanyl-12,17-dioxa-2,4,6,8,21-pentazatricyclo[21.2.2.13,7]octacosa-1(25),3,5,7(28),23,26-hexaen-22-one (PubChem CID 89458634) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is 5-methylsulfanyl-12,17-dioxa-2,4,6,8,21-pentazatricyclo[21.2.2.13,7]octacosa-1(25),3,5,7(28),23,26-hexaen-22-one.
| Compound Name | 5-methylsulfanyl-12,17-dioxa-2,4,6,8,21-pentazatricyclo[21.2.2.13,7]octacosa-1(25),3,5,7(28),23,26-hexaen-22-one |
|---|---|
| PubChem CID | 89458634 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | 5-methylsulfanyl-12,17-dioxa-2,4,6,8,21-pentazatricyclo[21.2.2.13,7]octacosa-1(25),3,5,7(28),23,26-hexaen-22-one |
| SMILES | CSc1nc2cc(n1)Nc1ccc(cc1)C(=O)NCCCOCCCCOCCCN2 |
| InChI | InChI=1S/C22H31N5O3S/c1-31-22-26-19-16-20(27-22)25-18-8-6-17(7-9-18)21(28)24-11-5-15-30-13-3-2-12-29-14-4-10-23-19/h6-9,16H,2-5,10-15H2,1H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | AXXUEKMCBSSRSC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |