C26H21N5O — CID 89459064
5-(5-amino-3-pyridinyl)-N-(3-benzylphenyl)-1H-indazole-3-carboxamide (PubChem CID 89459064) has the molecular formula C26H21N5O and a molecular weight of 419.49 g/mol. Its IUPAC name is 5-(5-amino-3-pyridinyl)-N-(3-benzylphenyl)-1H-indazole-3-carboxamide.
| Compound Name | 5-(5-amino-3-pyridinyl)-N-(3-benzylphenyl)-1H-indazole-3-carboxamide |
|---|---|
| PubChem CID | 89459064 |
| Molecular Formula | C26H21N5O |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 5-(5-amino-3-pyridinyl)-N-(3-benzylphenyl)-1H-indazole-3-carboxamide |
| SMILES | Nc1cncc(-c2ccc3[nH]nc(C(=O)Nc4cccc(Cc5ccccc5)c4)c3c2)c1 |
| InChI | InChI=1S/C26H21N5O/c27-21-13-20(15-28-16-21)19-9-10-24-23(14-19)25(31-30-24)26(32)29-22-8-4-7-18(12-22)11-17-5-2-1-3-6-17/h1-10,12-16H,11,27H2,(H,29,32)(H,30,31) |
| InChIKey | SHCMHHQMUYQUIF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |