C25H25FN4O3S — CID 89459538
(1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(4-fluoro-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate (PubChem CID 89459538) has the molecular formula C25H25FN4O3S and a molecular weight of 480.57 g/mol. Its IUPAC name is (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(4-fluoro-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
| Compound Name | (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(4-fluoro-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 89459538 |
| Molecular Formula | C25H25FN4O3S |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(4-fluoro-2-methoxyphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| SMILES | COc1cc(F)ccc1-c1nc(C)c(NC(=O)OCc2ccc3c(c2)nc2n3C(C)CCC2)s1 |
| InChI | InChI=1S/C25H25FN4O3S/c1-14-5-4-6-22-28-19-11-16(7-10-20(19)30(14)22)13-33-25(31)29-23-15(2)27-24(34-23)18-9-8-17(26)12-21(18)32-3/h7-12,14H,4-6,13H2,1-3H3,(H,29,31) |
| InChIKey | MUUDVXPADGPOOZ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |