C26H28N4O2S — CID 89459540
(1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate (PubChem CID 89459540) has the molecular formula C26H28N4O2S and a molecular weight of 460.60 g/mol. Its IUPAC name is (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate.
| Compound Name | (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
|---|---|
| PubChem CID | 89459540 |
| Molecular Formula | C26H28N4O2S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.19 |
| IUPAC Name | (1-methyl-1,2,3,4-tetrahydropyrido[1,2-a]benzimidazol-7-yl)methyl N-[2-(2,4-dimethylphenyl)-4-methyl-1,3-thiazol-5-yl]carbamate |
| SMILES | Cc1ccc(-c2nc(C)c(NC(=O)OCc3ccc4c(c3)nc3n4C(C)CCC3)s2)c(C)c1 |
| InChI | InChI=1S/C26H28N4O2S/c1-15-8-10-20(16(2)12-15)25-27-18(4)24(33-25)29-26(31)32-14-19-9-11-22-21(13-19)28-23-7-5-6-17(3)30(22)23/h8-13,17H,5-7,14H2,1-4H3,(H,29,31) |
| InChIKey | DYNDNUMCGZWHOF-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |