C19H17N3O6S — CID 8945955
[(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] 2-(2-nitrophenyl)sulfanylacetate (PubChem CID 8945955) has the molecular formula C19H17N3O6S and a molecular weight of 415.43 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] 2-(2-nitrophenyl)sulfanylacetate.
| Compound Name | [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] 2-(2-nitrophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8945955 |
| Molecular Formula | C19H17N3O6S |
| Molecular Weight | 415.43 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | [(2R)-1-oxo-1-(3-oxo-2,4-dihydroquinoxalin-1-yl)propan-2-yl] 2-(2-nitrophenyl)sulfanylacetate |
| SMILES | C[C@@H](OC(=O)CSc1ccccc1[N+](=O)[O-])C(=O)N1CC(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H17N3O6S/c1-12(19(25)21-10-17(23)20-13-6-2-3-7-14(13)21)28-18(24)11-29-16-9-5-4-8-15(16)22(26)27/h2-9,12H,10-11H2,1H3,(H,20,23)/t12-/m1/s1 |
| InChIKey | VXEKFOCSSUMXOA-GFCCVEGCSA-N |
| XLogP | 2.60 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.43 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|