About (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate
(1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate (PubChem CID 89459589) has the molecular formula C22H21FN4O2S
and a molecular weight of 424.50 g/mol. Its IUPAC name is (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate.
Molecular Properties
| Compound Name | (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate |
| PubChem CID | 89459589 |
| Molecular Formula | C22H21FN4O2S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate |
| SMILES | CCc1nc(-c2ccc(F)cc2C)sc1NC(=O)OCc1ccc2c(c1)ncn2C |
| InChI | InChI=1S/C22H21FN4O2S/c1-4-17-21(30-20(25-17)16-7-6-15(23)9-13(16)2)26-22(28)29-11-14-5-8-19-18(10-14)24-12-27(19)3/h5-10,12H,4,11H2,1-3H3,(H,26,28) |
| InChIKey | VOINYPGJHRBCKM-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate?
The IUPAC name of (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate (CID 89459589) is (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate.
What is the SMILES notation for (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate?
The canonical SMILES for (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate is CCc1nc(-c2ccc(F)cc2C)sc1NC(=O)OCc1ccc2c(c1)ncn2C.
What is the InChIKey of (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate?
The InChIKey is VOINYPGJHRBCKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21FN4O2S/c1-4-17-21(30-20(25-17)16-7-6-15(23)9-13(16)2)26-22(28)29-11-14-5-8-19-18(10-14)24-12-27(19)3/h5-10,12H,4,11H2,1-3H3,(H,26,28).
What are the key properties of (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate?
(1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate has a molecular weight of 424.50 g/mol, XLogP of 5.46, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylbenzimidazol-5-yl)methyl N-[4-ethyl-2-(4-fluoro-2-methylphenyl)-1,3-thiazol-5-yl]carbamate is sourced from PubChem (CID 89459589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).