C22H22ClN7S — CID 89460808
3-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1,5-naphthyridine (PubChem CID 89460808) has the molecular formula C22H22ClN7S and a molecular weight of 451.99 g/mol. Its IUPAC name is 3-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1,5-naphthyridine.
| Compound Name | 3-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1,5-naphthyridine |
|---|---|
| PubChem CID | 89460808 |
| Molecular Formula | C22H22ClN7S |
| Molecular Weight | 451.99 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 3-[[4-(2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl)-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]sulfanyl]-1,5-naphthyridine |
| SMILES | CCc1[nH]c2nc(Sc3cnc4cccnc4c3)nc(N3CC4CCNC4C3)c2c1Cl |
| InChI | InChI=1S/C22H22ClN7S/c1-2-14-19(23)18-20(27-14)28-22(29-21(18)30-10-12-5-7-25-17(12)11-30)31-13-8-16-15(26-9-13)4-3-6-24-16/h3-4,6,8-9,12,17,25H,2,5,7,10-11H2,1H3,(H,27,28,29) |
| InChIKey | IFPUVAZYPLRBEC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.99 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |