C17H17ClN6O3 — CID 89460896
3-[[4-[1,1-bis(hydroxyamino)ethyl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]oxy]benzonitrile (PubChem CID 89460896) has the molecular formula C17H17ClN6O3 and a molecular weight of 388.82 g/mol. Its IUPAC name is 3-[[4-[1,1-bis(hydroxyamino)ethyl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]oxy]benzonitrile.
| Compound Name | 3-[[4-[1,1-bis(hydroxyamino)ethyl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 89460896 |
| Molecular Formula | C17H17ClN6O3 |
| Molecular Weight | 388.82 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[4-[1,1-bis(hydroxyamino)ethyl]-5-chloro-6-ethyl-7H-pyrrolo[2,3-d]pyrimidin-2-yl]oxy]benzonitrile |
| SMILES | CCc1[nH]c2nc(Oc3cccc(C#N)c3)nc(C(C)(NO)NO)c2c1Cl |
| InChI | InChI=1S/C17H17ClN6O3/c1-3-11-13(18)12-14(17(2,23-25)24-26)21-16(22-15(12)20-11)27-10-6-4-5-9(7-10)8-19/h4-7,23-26H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | XBWSJRNJGGXKPO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 139.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.82 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|