About 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate
2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate (PubChem CID 89462003) has the molecular formula C9H13F3N2O2
and a molecular weight of 238.21 g/mol. Its IUPAC name is 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate |
| PubChem CID | 89462003 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate |
| SMILES | N#CC[NH+]1CCCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H12N2.C2HF3O2/c8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-7H2;(H,6,7) |
| InChIKey | JRPHXQUCBUKIKZ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate?
The IUPAC name of 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate (CID 89462003) is 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate.
What is the SMILES notation for 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate?
The canonical SMILES for 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate is N#CC[NH+]1CCCCC1.O=C([O-])C(F)(F)F.
What is the InChIKey of 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate?
The InChIKey is JRPHXQUCBUKIKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2.C2HF3O2/c8-4-7-9-5-2-1-3-6-9;3-2(4,5)1(6)7/h1-3,5-7H2;(H,6,7).
What are the key properties of 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate?
2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate has a molecular weight of 238.21 g/mol, XLogP of -1.12, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ium-1-ylacetonitrile;2,2,2-trifluoroacetate is sourced from PubChem (CID 89462003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).