C30H36F3N4O3P — CID 89462609
4-[4-[methanehydrazonoyl(methyl)amino]butanoylamino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 89462609) has the molecular formula C30H36F3N4O3P and a molecular weight of 588.61 g/mol. Its IUPAC name is 4-[4-[methanehydrazonoyl(methyl)amino]butanoylamino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 4-[4-[methanehydrazonoyl(methyl)amino]butanoylamino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89462609 |
| Molecular Formula | C30H36F3N4O3P |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.25 |
| IUPAC Name | 4-[4-[methanehydrazonoyl(methyl)amino]butanoylamino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | CN(C=NN)CCCC(=O)NCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H35N4OP.C2HF3O2/c1-32(24-31-29)22-13-20-28(33)30-21-11-12-23-34(25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27;3-2(4,5)1(6)7/h2-10,14-19,24H,11-13,20-23,29H2,1H3;(H,6,7) |
| InChIKey | OOAVFHBQPCITNC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 110.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|