About 4-ethylicosanedioic acid;dihydrochloride
4-ethylicosanedioic acid;dihydrochloride (PubChem CID 89462723) has the molecular formula C22H44Cl2O4
and a molecular weight of 443.50 g/mol. Its IUPAC name is 4-ethylicosanedioic acid;dihydrochloride.
Molecular Properties
| Compound Name | 4-ethylicosanedioic acid;dihydrochloride |
| PubChem CID | 89462723 |
| Molecular Formula | C22H44Cl2O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-ethylicosanedioic acid;dihydrochloride |
| SMILES | CCC(CCCCCCCCCCCCCCCC(=O)O)CCC(=O)O.Cl.Cl |
| InChI | InChI=1S/C22H42O4.2ClH/c1-2-20(18-19-22(25)26)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-21(23)24;;/h20H,2-19H2,1H3,(H,23,24)(H,25,26);2*1H |
| InChIKey | AQIXMPHEZKVVTO-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-ethylicosanedioic acid;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylicosanedioic acid;dihydrochloride?
The IUPAC name of 4-ethylicosanedioic acid;dihydrochloride (CID 89462723) is 4-ethylicosanedioic acid;dihydrochloride.
What is the SMILES notation for 4-ethylicosanedioic acid;dihydrochloride?
The canonical SMILES for 4-ethylicosanedioic acid;dihydrochloride is CCC(CCCCCCCCCCCCCCCC(=O)O)CCC(=O)O.Cl.Cl.
What is the InChIKey of 4-ethylicosanedioic acid;dihydrochloride?
The InChIKey is AQIXMPHEZKVVTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4.2ClH/c1-2-20(18-19-22(25)26)16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-21(23)24;;/h20H,2-19H2,1H3,(H,23,24)(H,25,26);2*1H.
What are the key properties of 4-ethylicosanedioic acid;dihydrochloride?
4-ethylicosanedioic acid;dihydrochloride has a molecular weight of 443.50 g/mol, XLogP of 7.66, 20 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylicosanedioic acid;dihydrochloride is sourced from PubChem (CID 89462723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).