C27H31F3N2O3P+ — CID 89462811
3-[[2-(dimethylamino)-2-oxoethyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid (PubChem CID 89462811) has the molecular formula C27H31F3N2O3P+ and a molecular weight of 519.52 g/mol. Its IUPAC name is 3-[[2-(dimethylamino)-2-oxoethyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[2-(dimethylamino)-2-oxoethyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89462811 |
| Molecular Formula | C27H31F3N2O3P+ |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 3-[[2-(dimethylamino)-2-oxoethyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CNCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H30N2OP.C2HF3O2/c1-27(2)25(28)21-26-19-12-20-29(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;3-2(4,5)1(6)7/h3-11,13-18,26H,12,19-21H2,1-2H3;(H,6,7)/q+1; |
| InChIKey | WDTIMIVFGAEUDY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|