C32H40F3N4O3P — CID 89463050
4-[[4-[carbamimidoyl(methyl)amino]-2,2-dimethylbutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate (PubChem CID 89463050) has the molecular formula C32H40F3N4O3P and a molecular weight of 616.67 g/mol. Its IUPAC name is 4-[[4-[carbamimidoyl(methyl)amino]-2,2-dimethylbutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate.
| Compound Name | 4-[[4-[carbamimidoyl(methyl)amino]-2,2-dimethylbutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 89463050 |
| Molecular Formula | C32H40F3N4O3P |
| Molecular Weight | 616.67 g/mol |
| Exact Mass | 616.28 |
| IUPAC Name | 4-[[4-[carbamimidoyl(methyl)amino]-2,2-dimethylbutanoyl]amino]butyl-triphenylphosphanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[H]/N=C(\N)N(C)CCC(C)(C)C(=O)NCCCC[P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H39N4OP.C2HF3O2/c1-30(2,21-23-34(3)29(31)32)28(35)33-22-13-14-24-36(25-15-7-4-8-16-25,26-17-9-5-10-18-26)27-19-11-6-12-20-27;3-2(4,5)1(6)7/h4-12,15-20H,13-14,21-24H2,1-3H3,(H3-,31,32,33,35);(H,6,7) |
| InChIKey | RKCIWUMGCYSTRR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 122.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.67 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|