C30H35F3N4O3P+ — CID 89463113
3-[[1-[[carbamimidoyl(methyl)amino]methyl]cyclopropanecarbonyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid (PubChem CID 89463113) has the molecular formula C30H35F3N4O3P+ and a molecular weight of 587.60 g/mol. Its IUPAC name is 3-[[1-[[carbamimidoyl(methyl)amino]methyl]cyclopropanecarbonyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[1-[[carbamimidoyl(methyl)amino]methyl]cyclopropanecarbonyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89463113 |
| Molecular Formula | C30H35F3N4O3P+ |
| Molecular Weight | 587.60 g/mol |
| Exact Mass | 587.24 |
| IUPAC Name | 3-[[1-[[carbamimidoyl(methyl)amino]methyl]cyclopropanecarbonyl]amino]propyl-triphenylphosphanium;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)N(C)CC1(C(=O)NCCC[P+](c2ccccc2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C28H33N4OP.C2HF3O2/c1-32(27(29)30)22-28(18-19-28)26(33)31-20-11-21-34(23-12-5-2-6-13-23,24-14-7-3-8-15-24)25-16-9-4-10-17-25;3-2(4,5)1(6)7/h2-10,12-17H,11,18-22H2,1H3,(H3-,29,30,31,33);(H,6,7)/p+1 |
| InChIKey | QIJSFUBISSXVBO-UHFFFAOYSA-O |
| XLogP | 3.73 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|