C30H26F3N3O2 — CID 89463632
N-pyridin-3-yl-4-[2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]naphthalen-2-yl]ethylidene]cyclohexane-1-carboxamide (PubChem CID 89463632) has the molecular formula C30H26F3N3O2 and a molecular weight of 517.55 g/mol. Its IUPAC name is N-pyridin-3-yl-4-[2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]naphthalen-2-yl]ethylidene]cyclohexane-1-carboxamide.
| Compound Name | N-pyridin-3-yl-4-[2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]naphthalen-2-yl]ethylidene]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 89463632 |
| Molecular Formula | C30H26F3N3O2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.20 |
| IUPAC Name | N-pyridin-3-yl-4-[2-[4-[[5-(trifluoromethyl)-2-pyridinyl]oxy]naphthalen-2-yl]ethylidene]cyclohexane-1-carboxamide |
| SMILES | O=C(Nc1cccnc1)C1CCC(=CCc2cc(Oc3ccc(C(F)(F)F)cn3)c3ccccc3c2)CC1 |
| InChI | InChI=1S/C30H26F3N3O2/c31-30(32,33)24-13-14-28(35-18-24)38-27-17-21(16-23-4-1-2-6-26(23)27)8-7-20-9-11-22(12-10-20)29(37)36-25-5-3-15-34-19-25/h1-7,13-19,22H,8-12H2,(H,36,37)/b20-7- |
| InChIKey | RGEALQDXWOIBDM-SCDVKCJHSA-N |
| XLogP | 7.74 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|