C36H43F3N2O8SSi — CID 89464353
[3-[[1-[tert-butyl(dimethyl)silyl]oxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]-6,7,8-trimethoxy-9,10-dihydrophenanthren-2-yl] trifluoromethanesulfonate (PubChem CID 89464353) has the molecular formula C36H43F3N2O8SSi and a molecular weight of 748.89 g/mol. Its IUPAC name is [3-[[1-[tert-butyl(dimethyl)silyl]oxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]-6,7,8-trimethoxy-9,10-dihydrophenanthren-2-yl] trifluoromethanesulfonate.
| Compound Name | [3-[[1-[tert-butyl(dimethyl)silyl]oxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]-6,7,8-trimethoxy-9,10-dihydrophenanthren-2-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 89464353 |
| Molecular Formula | C36H43F3N2O8SSi |
| Molecular Weight | 748.89 g/mol |
| Exact Mass | 748.25 |
| IUPAC Name | [3-[[1-[tert-butyl(dimethyl)silyl]oxy-3-(1H-indol-3-yl)propan-2-yl]carbamoyl]-6,7,8-trimethoxy-9,10-dihydrophenanthren-2-yl] trifluoromethanesulfonate |
| SMILES | COc1cc2c(c(OC)c1OC)CCc1cc(OS(=O)(=O)C(F)(F)F)c(C(=O)NC(CO[Si](C)(C)C(C)(C)C)Cc3c[nH]c4ccccc34)cc1-2 |
| InChI | InChI=1S/C36H43F3N2O8SSi/c1-35(2,3)51(7,8)48-20-23(15-22-19-40-29-12-10-9-11-24(22)29)41-34(42)28-17-26-21(16-30(28)49-50(43,44)36(37,38)39)13-14-25-27(26)18-31(45-4)33(47-6)32(25)46-5/h9-12,16-19,23,40H,13-15,20H2,1-8H3,(H,41,42) |
| InChIKey | UBHXBKYIMHEHPY-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 125.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.89 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|