About 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid
5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 89464649) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid.
Molecular Properties
| Compound Name | 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| PubChem CID | 89464649 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | N#CC1=CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C7H8N2O2/c8-4-6-2-1-3-9(5-6)7(10)11/h2H,1,3,5H2,(H,10,11) |
| InChIKey | QMITVXYYEYJNDD-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The IUPAC name of 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid (CID 89464649) is 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid.
What is the SMILES notation for 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The canonical SMILES for 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid is N#CC1=CCCN(C(=O)O)C1.
What is the InChIKey of 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid?
The InChIKey is QMITVXYYEYJNDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-4-6-2-1-3-9(5-6)7(10)11/h2H,1,3,5H2,(H,10,11).
What are the key properties of 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid?
5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid has a molecular weight of 152.15 g/mol, XLogP of 0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-3,6-dihydro-2H-pyridine-1-carboxylic acid is sourced from PubChem (CID 89464649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).